C21H40O6Si — CID 10927873
(3S,4S)-4-[[(3aR,6S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]oxy]-2-methylhex-5-en-3-ol (PubChem CID 10927873) has the molecular formula C21H40O6Si and a molecular weight of 416.63 g/mol. Its IUPAC name is (3S,4S)-4-[[(3aR,6S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]oxy]-2-methylhex-5-en-3-ol.
| Compound Name | (3S,4S)-4-[[(3aR,6S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]oxy]-2-methylhex-5-en-3-ol |
|---|---|
| PubChem CID | 10927873 |
| Molecular Formula | C21H40O6Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (3S,4S)-4-[[(3aR,6S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]oxy]-2-methylhex-5-en-3-ol |
| SMILES | C=C[C@H](O[C@@H]1OC[C@H]2OC(C)(C)O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C)[C@@H](O)C(C)C |
| InChI | InChI=1S/C21H40O6Si/c1-11-14(16(22)13(2)3)24-19-18(27-28(9,10)20(4,5)6)17-15(12-23-19)25-21(7,8)26-17/h11,13-19,22H,1,12H2,2-10H3/t14-,15+,16-,17+,18-,19-/m0/s1 |
| InChIKey | LAKRYGJVWDEFRX-WXJALIKYSA-N |
| XLogP | 3.84 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|