C27H54O4Si2 — CID 10929179
[(3aS,6R,7R,10Z,13aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,8,9,12,13,13a-decahydrocyclododeca[d][1,3]dioxol-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10929179) has the molecular formula C27H54O4Si2 and a molecular weight of 498.90 g/mol. Its IUPAC name is [(3aS,6R,7R,10Z,13aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,8,9,12,13,13a-decahydrocyclododeca[d][1,3]dioxol-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,6R,7R,10Z,13aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,8,9,12,13,13a-decahydrocyclododeca[d][1,3]dioxol-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10929179 |
| Molecular Formula | C27H54O4Si2 |
| Molecular Weight | 498.90 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | [(3aS,6R,7R,10Z,13aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,8,9,12,13,13a-decahydrocyclododeca[d][1,3]dioxol-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@H]2CC/C=C\CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]2O1 |
| InChI | InChI=1S/C27H54O4Si2/c1-25(2,3)32(9,10)30-23-18-16-14-13-15-17-21-22(29-27(7,8)28-21)19-20-24(23)31-33(11,12)26(4,5)6/h13-14,21-24H,15-20H2,1-12H3/b14-13-/t21-,22-,23+,24+/m0/s1 |
| InChIKey | BNMXDVPJCJUXLB-YLQMDSRPSA-N |
| XLogP | 8.20 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.90 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|