C34H39NO5Si — CID 10929855
benzyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2R)-2-methyl-5-oxofuran-2-yl]pyrrolidine-1-carboxylate (PubChem CID 10929855) has the molecular formula C34H39NO5Si and a molecular weight of 569.77 g/mol. Its IUPAC name is benzyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2R)-2-methyl-5-oxofuran-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2R)-2-methyl-5-oxofuran-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10929855 |
| Molecular Formula | C34H39NO5Si |
| Molecular Weight | 569.77 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | benzyl (2S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2R)-2-methyl-5-oxofuran-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@@H]([C@@]2(C)C=CC(=O)O2)N1C(=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H39NO5Si/c1-33(2,3)41(28-16-10-6-11-17-28,29-18-12-7-13-19-29)39-25-27-20-21-30(34(4)23-22-31(36)40-34)35(27)32(37)38-24-26-14-8-5-9-15-26/h5-19,22-23,27,30H,20-21,24-25H2,1-4H3/t27-,30-,34+/m0/s1 |
| InChIKey | ONQMYZBMCJSPJT-ZWFYEVCOSA-N |
| XLogP | 5.60 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.77 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|