C14H19F3N2O2 — CID 109389622
1-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-pentan-3-ylurea (PubChem CID 109389622) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-pentan-3-ylurea.
| Compound Name | 1-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-pentan-3-ylurea |
|---|---|
| PubChem CID | 109389622 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-pentan-3-ylurea |
| SMILES | CCC(CC)NC(=O)NC(CO)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-3-9(4-2)18-14(21)19-12(7-20)8-5-10(15)13(17)11(16)6-8/h5-6,9,12,20H,3-4,7H2,1-2H3,(H2,18,19,21) |
| InChIKey | WOZKIGHZECIWJH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|