C19H27FN4O3S — CID 109444739
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 109444739) has the molecular formula C19H27FN4O3S and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 109444739 |
| Molecular Formula | C19H27FN4O3S |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NCc1cc(F)ccc1CS(C)(=O)=O |
| InChI | InChI=1S/C19H27FN4O3S/c1-19(2,3)16-10-22-17(27-16)11-24-18(21-4)23-9-14-8-15(20)7-6-13(14)12-28(5,25)26/h6-8,10H,9,11-12H2,1-5H3,(H2,21,23,24) |
| InChIKey | ADCWXPJBEMBFRM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|