C18H30FIN4O2S — CID 109444826
1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 109444826) has the molecular formula C18H30FIN4O2S and a molecular weight of 512.43 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109444826 |
| Molecular Formula | C18H30FIN4O2S |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCN1CCCC1CN/C(=N\C)NCc1cc(F)ccc1CS(C)(=O)=O.I |
| InChI | InChI=1S/C18H29FN4O2S.HI/c1-4-23-9-5-6-17(23)12-22-18(20-2)21-11-15-10-16(19)8-7-14(15)13-26(3,24)25;/h7-8,10,17H,4-6,9,11-13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | JUIPPDRPQFRECV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|