C21H36N4O3S — CID 109492932
2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]guanidine (PubChem CID 109492932) has the molecular formula C21H36N4O3S and a molecular weight of 424.61 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]guanidine.
| Compound Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109492932 |
| Molecular Formula | C21H36N4O3S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(C(C)(C)C)cc1)NC[C@H]1CCCN1S(C)(=O)=O |
| InChI | InChI=1S/C21H36N4O3S/c1-6-22-20(23-14-18-8-7-13-25(18)29(5,27)28)24-15-19(26)16-9-11-17(12-10-16)21(2,3)4/h9-12,18-19,26H,6-8,13-15H2,1-5H3,(H2,22,23,24)/t18-,19?/m1/s1 |
| InChIKey | PMBFBWBDISXQQB-MRTLOADZSA-N |
| XLogP | 2.00 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|