C28H26N2O5 — CID 10950792
methyl (4E)-4-phenyl-4-[[4-[(2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]butanoate (PubChem CID 10950792) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is methyl (4E)-4-phenyl-4-[[4-[(2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]butanoate.
| Compound Name | methyl (4E)-4-phenyl-4-[[4-[(2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]butanoate |
|---|---|
| PubChem CID | 10950792 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | methyl (4E)-4-phenyl-4-[[4-[(2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]butanoate |
| SMILES | COC(=O)CC/C(=N\OCc1ccc(OCc2coc(-c3ccccc3)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H26N2O5/c1-32-27(31)17-16-26(22-8-4-2-5-9-22)30-35-18-21-12-14-25(15-13-21)33-19-24-20-34-28(29-24)23-10-6-3-7-11-23/h2-15,20H,16-19H2,1H3/b30-26+ |
| InChIKey | TVIPQVPRIDHRKQ-URGPHPNLSA-N |
| XLogP | 5.79 |
| TPSA | 83.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|