C31H32N2O7 — CID 86589851
methyl (4Z)-4-[[3,5-dimethoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-4-phenylbutanoate (PubChem CID 86589851) has the molecular formula C31H32N2O7 and a molecular weight of 544.60 g/mol. Its IUPAC name is methyl (4Z)-4-[[3,5-dimethoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-4-phenylbutanoate.
| Compound Name | methyl (4Z)-4-[[3,5-dimethoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 86589851 |
| Molecular Formula | C31H32N2O7 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | methyl (4Z)-4-[[3,5-dimethoxy-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyimino]-4-phenylbutanoate |
| SMILES | COC(=O)CC/C(=N/OCc1cc(OC)c(OCc2nc(-c3ccccc3)oc2C)c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C31H32N2O7/c1-21-26(32-31(40-21)24-13-9-6-10-14-24)20-38-30-27(35-2)17-22(18-28(30)36-3)19-39-33-25(15-16-29(34)37-4)23-11-7-5-8-12-23/h5-14,17-18H,15-16,19-20H2,1-4H3/b33-25- |
| InChIKey | UHDFGWNQZIGQNP-IVQJCJPDSA-N |
| XLogP | 6.12 |
| TPSA | 101.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|