C36H72O6Si3 — CID 10952542
(2R)-3-[[(2S,4S,6R,8S,10S)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-4,10-bis(triethylsilyloxy)-1,7-dioxaspiro[5.5]undecan-2-yl]methyl]-2-methylbut-3-enal (PubChem CID 10952542) has the molecular formula C36H72O6Si3 and a molecular weight of 685.22 g/mol. Its IUPAC name is (2R)-3-[[(2S,4S,6R,8S,10S)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-4,10-bis(triethylsilyloxy)-1,7-dioxaspiro[5.5]undecan-2-yl]methyl]-2-methylbut-3-enal.
| Compound Name | (2R)-3-[[(2S,4S,6R,8S,10S)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-4,10-bis(triethylsilyloxy)-1,7-dioxaspiro[5.5]undecan-2-yl]methyl]-2-methylbut-3-enal |
|---|---|
| PubChem CID | 10952542 |
| Molecular Formula | C36H72O6Si3 |
| Molecular Weight | 685.22 g/mol |
| Exact Mass | 684.46 |
| IUPAC Name | (2R)-3-[[(2S,4S,6R,8S,10S)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-4,10-bis(triethylsilyloxy)-1,7-dioxaspiro[5.5]undecan-2-yl]methyl]-2-methylbut-3-enal |
| SMILES | C=C(C[C@H]1C[C@](C)(O[Si](CC)(CC)CC)C[C@@]2(C[C@@H](O[Si](CC)(CC)CC)C[C@H](CCO[Si](C)(C)C(C)(C)C)O2)O1)[C@@H](C)C=O |
| InChI | InChI=1S/C36H72O6Si3/c1-15-44(16-2,17-3)41-33-24-31(21-22-38-43(13,14)34(9,10)11)39-36(26-33)28-35(12,42-45(18-4,19-5)20-6)25-32(40-36)23-29(7)30(8)27-37/h27,30-33H,7,15-26,28H2,1-6,8-14H3/t30-,31-,32-,33-,35-,36+/m0/s1 |
| InChIKey | HETMBTCMODRNIP-VUXDEMLTSA-N |
| XLogP | 10.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.22 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|