C32H64O5Si2 — CID 11060956
(2R)-4-[(2S,3S,6R,8S,9R,10S)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-3,9-dimethyl-10-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]-2-ethylbutanal (PubChem CID 11060956) has the molecular formula C32H64O5Si2 and a molecular weight of 585.03 g/mol. Its IUPAC name is (2R)-4-[(2S,3S,6R,8S,9R,10S)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-3,9-dimethyl-10-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]-2-ethylbutanal.
| Compound Name | (2R)-4-[(2S,3S,6R,8S,9R,10S)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-3,9-dimethyl-10-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]-2-ethylbutanal |
|---|---|
| PubChem CID | 11060956 |
| Molecular Formula | C32H64O5Si2 |
| Molecular Weight | 585.03 g/mol |
| Exact Mass | 584.43 |
| IUPAC Name | (2R)-4-[(2S,3S,6R,8S,9R,10S)-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-3,9-dimethyl-10-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]-2-ethylbutanal |
| SMILES | CC[C@@H](C=O)CC[C@@H]1O[C@]2(CC[C@H](C)[C@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O2)C[C@H](O[Si](CC)(CC)CC)[C@@H]1C |
| InChI | InChI=1S/C32H64O5Si2/c1-13-27(23-33)17-18-28-26(7)30(37-39(14-2,15-3)16-4)22-32(34-28)20-19-24(5)29(35-32)21-25(6)36-38(11,12)31(8,9)10/h23-30H,13-22H2,1-12H3/t24-,25+,26+,27+,28-,29-,30-,32-/m0/s1 |
| InChIKey | CSHRHCKUIGDZPN-VLIRGQNNSA-N |
| XLogP | 9.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.03 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|