C28H45Cl3O8Si — CID 11028661
2,2,2-trichloroethyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-oxobutyl]-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate (PubChem CID 11028661) has the molecular formula C28H45Cl3O8Si and a molecular weight of 644.11 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-oxobutyl]-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate.
| Compound Name | 2,2,2-trichloroethyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-oxobutyl]-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
|---|---|
| PubChem CID | 11028661 |
| Molecular Formula | C28H45Cl3O8Si |
| Molecular Weight | 644.11 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[(2S,4S,6S,8R,10S)-10-acetyloxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-oxobutyl]-4-triethylsilyloxy-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
| SMILES | C=C(C[C@H]1C[C@](C)(O[Si](CC)(CC)CC)C[C@@]2(C[C@@H](OC(C)=O)C[C@H](CC(=O)OCC(Cl)(Cl)Cl)O2)O1)[C@@H](C)C=O |
| InChI | InChI=1S/C28H45Cl3O8Si/c1-8-40(9-2,10-3)39-26(7)14-24(11-19(4)20(5)16-32)38-27(17-26)15-23(36-21(6)33)12-22(37-27)13-25(34)35-18-28(29,30)31/h16,20,22-24H,4,8-15,17-18H2,1-3,5-7H3/t20-,22+,23-,24-,26-,27+/m0/s1 |
| InChIKey | WXSOATPVHITEGP-DCFQGVOYSA-N |
| XLogP | 6.84 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.11 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|