C33H58N3O9PSi2 — CID 10952693
1-[(2R,3R,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(S)-diethoxyphosphoryl-[(4-methoxyphenyl)methylamino]methyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10952693) has the molecular formula C33H58N3O9PSi2 and a molecular weight of 727.98 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(S)-diethoxyphosphoryl-[(4-methoxyphenyl)methylamino]methyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(S)-diethoxyphosphoryl-[(4-methoxyphenyl)methylamino]methyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10952693 |
| Molecular Formula | C33H58N3O9PSi2 |
| Molecular Weight | 727.98 g/mol |
| Exact Mass | 727.34 |
| IUPAC Name | 1-[(2R,3R,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(S)-diethoxyphosphoryl-[(4-methoxyphenyl)methylamino]methyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCOP(=O)(OCC)[C@H](NCc1ccc(OC)cc1)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H58N3O9PSi2/c1-14-41-46(39,42-15-2)29(34-22-23-16-18-24(40-9)19-17-23)27-26(44-47(10,11)32(3,4)5)28(45-48(12,13)33(6,7)8)30(43-27)36-21-20-25(37)35-31(36)38/h16-21,26-30,34H,14-15,22H2,1-13H3,(H,35,37,38)/t26-,27+,28-,29+,30-/m1/s1 |
| InChIKey | ARKLZMLCWPHQMO-APMFGMRCSA-N |
| XLogP | 6.61 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.98 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|