C18H18O4 — CID 10957486
dimethyl (2R,3aS,5S)-2-ethenyl-2,5-dihydro-1H-acenaphthylene-3a,5-dicarboxylate (PubChem CID 10957486) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is dimethyl (2R,3aS,5S)-2-ethenyl-2,5-dihydro-1H-acenaphthylene-3a,5-dicarboxylate.
| Compound Name | dimethyl (2R,3aS,5S)-2-ethenyl-2,5-dihydro-1H-acenaphthylene-3a,5-dicarboxylate |
|---|---|
| PubChem CID | 10957486 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | dimethyl (2R,3aS,5S)-2-ethenyl-2,5-dihydro-1H-acenaphthylene-3a,5-dicarboxylate |
| SMILES | C=C[C@H]1Cc2cccc3c2[C@]1(C(=O)OC)C=C[C@@H]3C(=O)OC |
| InChI | InChI=1S/C18H18O4/c1-4-12-10-11-6-5-7-13-14(16(19)21-2)8-9-18(12,15(11)13)17(20)22-3/h4-9,12,14H,1,10H2,2-3H3/t12-,14-,18-/m0/s1 |
| InChIKey | AOHUBDOWWWWOGO-YEWDVWPNSA-N |
| XLogP | 2.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|