C17H23NO4 — CID 10957709
(3S,4R)-1-methoxy-3-[(1R)-1-(phenylmethoxymethoxy)ethyl]-4-prop-2-enylazetidin-2-one (PubChem CID 10957709) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (3S,4R)-1-methoxy-3-[(1R)-1-(phenylmethoxymethoxy)ethyl]-4-prop-2-enylazetidin-2-one.
| Compound Name | (3S,4R)-1-methoxy-3-[(1R)-1-(phenylmethoxymethoxy)ethyl]-4-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 10957709 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (3S,4R)-1-methoxy-3-[(1R)-1-(phenylmethoxymethoxy)ethyl]-4-prop-2-enylazetidin-2-one |
| SMILES | C=CC[C@@H]1[C@@H]([C@@H](C)OCOCc2ccccc2)C(=O)N1OC |
| InChI | InChI=1S/C17H23NO4/c1-4-8-15-16(17(19)18(15)20-3)13(2)22-12-21-11-14-9-6-5-7-10-14/h4-7,9-10,13,15-16H,1,8,11-12H2,2-3H3/t13-,15-,16-/m1/s1 |
| InChIKey | OPYDKOBUYKSEIO-FVQBIDKESA-N |
| XLogP | 2.53 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|