C17H14N2O7 — CID 10959272
2-[bis(5-methylfuran-2-yl)methyl]-4,6-dinitrophenol (PubChem CID 10959272) has the molecular formula C17H14N2O7 and a molecular weight of 358.31 g/mol. Its IUPAC name is 2-[bis(5-methylfuran-2-yl)methyl]-4,6-dinitrophenol.
| Compound Name | 2-[bis(5-methylfuran-2-yl)methyl]-4,6-dinitrophenol |
|---|---|
| PubChem CID | 10959272 |
| Molecular Formula | C17H14N2O7 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-[bis(5-methylfuran-2-yl)methyl]-4,6-dinitrophenol |
| SMILES | Cc1ccc(C(c2ccc(C)o2)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)o1 |
| InChI | InChI=1S/C17H14N2O7/c1-9-3-5-14(25-9)16(15-6-4-10(2)26-15)12-7-11(18(21)22)8-13(17(12)20)19(23)24/h3-8,16,20H,1-2H3 |
| InChIKey | YTOSDYKJKRRFRM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|