C14H31O6PSi — CID 10959337
tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-2-dimethoxyphosphorylacetate (PubChem CID 10959337) has the molecular formula C14H31O6PSi and a molecular weight of 354.46 g/mol. Its IUPAC name is tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-2-dimethoxyphosphorylacetate.
| Compound Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-2-dimethoxyphosphorylacetate |
|---|---|
| PubChem CID | 10959337 |
| Molecular Formula | C14H31O6PSi |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | tert-butyl 2-[tert-butyl(dimethyl)silyl]oxy-2-dimethoxyphosphorylacetate |
| SMILES | COP(=O)(OC)C(O[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H31O6PSi/c1-13(2,3)19-11(15)12(21(16,17-7)18-8)20-22(9,10)14(4,5)6/h12H,1-10H3 |
| InChIKey | MTDZKTMDRWBNGX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|