C18H26F4O4S — CID 10960640
(2S,3S,4R,5S)-4-fluoro-6,6-dimethyl-3-[(4-methylphenyl)sulfonylmethyl]-4-(trifluoromethyl)heptane-2,5-diol (PubChem CID 10960640) has the molecular formula C18H26F4O4S and a molecular weight of 414.46 g/mol. Its IUPAC name is (2S,3S,4R,5S)-4-fluoro-6,6-dimethyl-3-[(4-methylphenyl)sulfonylmethyl]-4-(trifluoromethyl)heptane-2,5-diol.
| Compound Name | (2S,3S,4R,5S)-4-fluoro-6,6-dimethyl-3-[(4-methylphenyl)sulfonylmethyl]-4-(trifluoromethyl)heptane-2,5-diol |
|---|---|
| PubChem CID | 10960640 |
| Molecular Formula | C18H26F4O4S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | (2S,3S,4R,5S)-4-fluoro-6,6-dimethyl-3-[(4-methylphenyl)sulfonylmethyl]-4-(trifluoromethyl)heptane-2,5-diol |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H]([C@H](C)O)[C@@](F)([C@@H](O)C(C)(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H26F4O4S/c1-11-6-8-13(9-7-11)27(25,26)10-14(12(2)23)17(19,18(20,21)22)15(24)16(3,4)5/h6-9,12,14-15,23-24H,10H2,1-5H3/t12-,14-,15-,17+/m0/s1 |
| InChIKey | VMDOFARPJMYCGB-NZUILWFCSA-N |
| XLogP | 3.44 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |