C19H36O9Si — CID 10961098
methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,3R,4R,5S,6R)-6-(methoxymethoxy)-3-(methoxymethoxymethyl)-2,7-dioxabicyclo[2.2.1]heptan-5-yl]acetate (PubChem CID 10961098) has the molecular formula C19H36O9Si and a molecular weight of 436.57 g/mol. Its IUPAC name is methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,3R,4R,5S,6R)-6-(methoxymethoxy)-3-(methoxymethoxymethyl)-2,7-dioxabicyclo[2.2.1]heptan-5-yl]acetate.
| Compound Name | methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,3R,4R,5S,6R)-6-(methoxymethoxy)-3-(methoxymethoxymethyl)-2,7-dioxabicyclo[2.2.1]heptan-5-yl]acetate |
|---|---|
| PubChem CID | 10961098 |
| Molecular Formula | C19H36O9Si |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,3R,4R,5S,6R)-6-(methoxymethoxy)-3-(methoxymethoxymethyl)-2,7-dioxabicyclo[2.2.1]heptan-5-yl]acetate |
| SMILES | COCOC[C@H]1O[C@H]2O[C@@H]1[C@H]([C@H](O[Si](C)(C)C(C)(C)C)C(=O)OC)[C@H]2OCOC |
| InChI | InChI=1S/C19H36O9Si/c1-19(2,3)29(7,8)28-15(17(20)23-6)13-14-12(9-24-10-21-4)26-18(27-14)16(13)25-11-22-5/h12-16,18H,9-11H2,1-8H3/t12-,13-,14+,15+,16-,18+/m1/s1 |
| InChIKey | TUJDVDMXVBZVSC-XDPVHMEUSA-N |
| XLogP | 1.90 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|