C26H54O9Si2 — CID 10793095
ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,3R,4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5-bis(methoxymethoxy)-3-methyloxan-2-yl]acetate (PubChem CID 10793095) has the molecular formula C26H54O9Si2 and a molecular weight of 566.88 g/mol. Its IUPAC name is ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,3R,4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5-bis(methoxymethoxy)-3-methyloxan-2-yl]acetate.
| Compound Name | ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,3R,4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5-bis(methoxymethoxy)-3-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 10793095 |
| Molecular Formula | C26H54O9Si2 |
| Molecular Weight | 566.88 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | ethyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,3R,4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5-bis(methoxymethoxy)-3-methyloxan-2-yl]acetate |
| SMILES | CCOC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCOC)[C@H](OCOC)[C@H]1C |
| InChI | InChI=1S/C26H54O9Si2/c1-15-30-23(27)21(34-36(11,12)25(3,4)5)20-18(2)19(31-16-28-9)22(32-17-29-10)24(33-20)35-37(13,14)26(6,7)8/h18-22,24H,15-17H2,1-14H3/t18-,19-,20-,21+,22+,24-/m1/s1 |
| InChIKey | IQWRQBZLAQPITI-PVNAXAEOSA-N |
| XLogP | 5.30 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.88 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|