C10H10Br2O3 — CID 10969787
3-(2,3-dibromo-4,5-dihydroxyphenyl)-2-methylpropanal (PubChem CID 10969787) has the molecular formula C10H10Br2O3 and a molecular weight of 338.00 g/mol. Its IUPAC name is 3-(2,3-dibromo-4,5-dihydroxyphenyl)-2-methylpropanal.
| Compound Name | 3-(2,3-dibromo-4,5-dihydroxyphenyl)-2-methylpropanal |
|---|---|
| PubChem CID | 10969787 |
| Molecular Formula | C10H10Br2O3 |
| Molecular Weight | 338.00 g/mol |
| Exact Mass | 335.90 |
| IUPAC Name | 3-(2,3-dibromo-4,5-dihydroxyphenyl)-2-methylpropanal |
| SMILES | CC(C=O)Cc1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C10H10Br2O3/c1-5(4-13)2-6-3-7(14)10(15)9(12)8(6)11/h3-5,14-15H,2H2,1H3 |
| InChIKey | SOFAADXWRQBUDW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.00 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|