C22H27NO3SSi — CID 10971698
2-[(4E)-4-[[dimethyl(phenyl)silyl]methylidene]-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]acetaldehyde (PubChem CID 10971698) has the molecular formula C22H27NO3SSi and a molecular weight of 413.62 g/mol. Its IUPAC name is 2-[(4E)-4-[[dimethyl(phenyl)silyl]methylidene]-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]acetaldehyde.
| Compound Name | 2-[(4E)-4-[[dimethyl(phenyl)silyl]methylidene]-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 10971698 |
| Molecular Formula | C22H27NO3SSi |
| Molecular Weight | 413.62 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-[(4E)-4-[[dimethyl(phenyl)silyl]methylidene]-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]acetaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C/[Si](C)(C)c3ccccc3)C(CC=O)C2)cc1 |
| InChI | InChI=1S/C22H27NO3SSi/c1-18-9-11-21(12-10-18)27(25,26)23-15-19(13-14-24)20(16-23)17-28(2,3)22-7-5-4-6-8-22/h4-12,14,17,19H,13,15-16H2,1-3H3/b20-17- |
| InChIKey | SVDAFOUTWJGQSO-JZJYNLBNSA-N |
| XLogP | 3.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.62 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|