C28H28O2P2+2 — CID 10973441
(2R,5S)-1,1,4,4-tetraphenyl-1,4-diphosphinane-1,4-diium-2,5-diol (PubChem CID 10973441) has the molecular formula C28H28O2P2+2 and a molecular weight of 458.48 g/mol. Its IUPAC name is (2R,5S)-1,1,4,4-tetraphenyl-1,4-diphosphinane-1,4-diium-2,5-diol.
| Compound Name | (2R,5S)-1,1,4,4-tetraphenyl-1,4-diphosphinane-1,4-diium-2,5-diol |
|---|---|
| PubChem CID | 10973441 |
| Molecular Formula | C28H28O2P2+2 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (2R,5S)-1,1,4,4-tetraphenyl-1,4-diphosphinane-1,4-diium-2,5-diol |
| SMILES | O[C@@H]1C[P+](c2ccccc2)(c2ccccc2)[C@@H](O)C[P+]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28O2P2/c29-27-22-32(25-17-9-3-10-18-25,26-19-11-4-12-20-26)28(30)21-31(27,23-13-5-1-6-14-23)24-15-7-2-8-16-24/h1-20,27-30H,21-22H2/q+2/t27-,28+ |
| InChIKey | VIBRKCRGAGVUIB-HNRBIFIRSA-N |
| XLogP | 3.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|