C13H20P+ — CID 23413587
(3R)-1,2,2,3-tetramethyl-1-phenylphosphetan-1-ium (PubChem CID 23413587) has the molecular formula C13H20P+ and a molecular weight of 207.28 g/mol. Its IUPAC name is (3R)-1,2,2,3-tetramethyl-1-phenylphosphetan-1-ium.
| Compound Name | (3R)-1,2,2,3-tetramethyl-1-phenylphosphetan-1-ium |
|---|---|
| PubChem CID | 23413587 |
| Molecular Formula | C13H20P+ |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (3R)-1,2,2,3-tetramethyl-1-phenylphosphetan-1-ium |
| SMILES | C[C@@H]1C[P+](C)(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C13H20P/c1-11-10-14(4,13(11,2)3)12-8-6-5-7-9-12/h5-9,11H,10H2,1-4H3/q+1/t11-,14?/m1/s1 |
| InChIKey | RPLIASANZKDDQX-YNODCEANSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|