C18H22P+ — CID 5111887
1,4,4-trimethyl-1-phenyl-2,3-dihydrophosphinolin-1-ium (PubChem CID 5111887) has the molecular formula C18H22P+ and a molecular weight of 269.35 g/mol. Its IUPAC name is 1,4,4-trimethyl-1-phenyl-2,3-dihydrophosphinolin-1-ium.
| Compound Name | 1,4,4-trimethyl-1-phenyl-2,3-dihydrophosphinolin-1-ium |
|---|---|
| PubChem CID | 5111887 |
| Molecular Formula | C18H22P+ |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1,4,4-trimethyl-1-phenyl-2,3-dihydrophosphinolin-1-ium |
| SMILES | CC1(C)CC[P+](C)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H22P/c1-18(2)13-14-19(3,15-9-5-4-6-10-15)17-12-8-7-11-16(17)18/h4-12H,13-14H2,1-3H3/q+1 |
| InChIKey | GHEYNHYQYGWROH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|