C20H19NPS+ — CID 139167382
(2R)-2-methyl-3,3-diphenyl-1,3-benzothiaphosphol-3-ium-2-amine (PubChem CID 139167382) has the molecular formula C20H19NPS+ and a molecular weight of 336.42 g/mol. Its IUPAC name is (2R)-2-methyl-3,3-diphenyl-1,3-benzothiaphosphol-3-ium-2-amine.
| Compound Name | (2R)-2-methyl-3,3-diphenyl-1,3-benzothiaphosphol-3-ium-2-amine |
|---|---|
| PubChem CID | 139167382 |
| Molecular Formula | C20H19NPS+ |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (2R)-2-methyl-3,3-diphenyl-1,3-benzothiaphosphol-3-ium-2-amine |
| SMILES | C[C@]1(N)Sc2ccccc2[P+]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H19NPS/c1-20(21)22(16-10-4-2-5-11-16,17-12-6-3-7-13-17)18-14-8-9-15-19(18)23-20/h2-15H,21H2,1H3/q+1/t20-/m1/s1 |
| InChIKey | OZROVWFKNBJHMI-HXUWFJFHSA-N |
| XLogP | 3.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|