C30H50O4S2Si — CID 10973804
(1R,2R)-2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-(2-methoxypropan-2-yloxy)-1-(6,6,8-trimethyl-1,4-dithiaspiro[4.5]dec-7-en-7-yl)ethanol (PubChem CID 10973804) has the molecular formula C30H50O4S2Si and a molecular weight of 566.95 g/mol. Its IUPAC name is (1R,2R)-2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-(2-methoxypropan-2-yloxy)-1-(6,6,8-trimethyl-1,4-dithiaspiro[4.5]dec-7-en-7-yl)ethanol.
| Compound Name | (1R,2R)-2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-(2-methoxypropan-2-yloxy)-1-(6,6,8-trimethyl-1,4-dithiaspiro[4.5]dec-7-en-7-yl)ethanol |
|---|---|
| PubChem CID | 10973804 |
| Molecular Formula | C30H50O4S2Si |
| Molecular Weight | 566.95 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | (1R,2R)-2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-(2-methoxypropan-2-yloxy)-1-(6,6,8-trimethyl-1,4-dithiaspiro[4.5]dec-7-en-7-yl)ethanol |
| SMILES | COC(C)(C)O[C@H](c1ccccc1CO[Si](C)(C)C(C)(C)C)[C@H](O)C1=C(C)CCC2(SCCS2)C1(C)C |
| InChI | InChI=1S/C30H50O4S2Si/c1-21-16-17-30(35-18-19-36-30)28(5,6)24(21)25(31)26(34-29(7,8)32-9)23-15-13-12-14-22(23)20-33-37(10,11)27(2,3)4/h12-15,25-26,31H,16-20H2,1-11H3/t25-,26-/m1/s1 |
| InChIKey | XPZZCWUEGYGNMP-CLJLJLNGSA-N |
| XLogP | 8.32 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.95 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|