C33H52O4SSi — CID 10973839
methyl (Z)-7-[(1R,2S,3S)-5-oxo-2-[(E,1R)-1-phenylsulfanyloct-2-enyl]-3-triethylsilyloxycyclopentyl]hept-5-enoate (PubChem CID 10973839) has the molecular formula C33H52O4SSi and a molecular weight of 572.93 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S,3S)-5-oxo-2-[(E,1R)-1-phenylsulfanyloct-2-enyl]-3-triethylsilyloxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S,3S)-5-oxo-2-[(E,1R)-1-phenylsulfanyloct-2-enyl]-3-triethylsilyloxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 10973839 |
| Molecular Formula | C33H52O4SSi |
| Molecular Weight | 572.93 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | methyl (Z)-7-[(1R,2S,3S)-5-oxo-2-[(E,1R)-1-phenylsulfanyloct-2-enyl]-3-triethylsilyloxycyclopentyl]hept-5-enoate |
| SMILES | CCCCC/C=C/[C@@H](Sc1ccccc1)[C@@H]1[C@@H](O[Si](CC)(CC)CC)CC(=O)[C@@H]1C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C33H52O4SSi/c1-6-10-11-12-19-24-31(38-27-21-16-15-17-22-27)33-28(23-18-13-14-20-25-32(35)36-5)29(34)26-30(33)37-39(7-2,8-3)9-4/h13,15-19,21-22,24,28,30-31,33H,6-12,14,20,23,25-26H2,1-5H3/b18-13-,24-19+/t28-,30-,31+,33-/m0/s1 |
| InChIKey | OLKBAFIYFVKSCV-PZILKRQISA-N |
| XLogP | 9.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.93 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|