C14H12Cl3N3O3 — CID 1097500
N-[(1R)-2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]benzamide (PubChem CID 1097500) has the molecular formula C14H12Cl3N3O3 and a molecular weight of 376.63 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]benzamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 1097500 |
| Molecular Formula | C14H12Cl3N3O3 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-(5-methyl-2,4-dioxopyrimidin-1-yl)ethyl]benzamide |
| SMILES | Cc1cn([C@@H](NC(=O)c2ccccc2)C(Cl)(Cl)Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H12Cl3N3O3/c1-8-7-20(13(23)19-10(8)21)12(14(15,16)17)18-11(22)9-5-3-2-4-6-9/h2-7,12H,1H3,(H,18,22)(H,19,21,23)/t12-/m1/s1 |
| InChIKey | BWDJOQZQPNTTSZ-GFCCVEGCSA-N |
| XLogP | 2.14 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|