C13H11Cl3FN3O3 — CID 74684281
N-[2,2,2-trichloro-1-(5-fluoro-2,4-dioxo-1,3-diazinan-1-yl)ethyl]benzamide (PubChem CID 74684281) has the molecular formula C13H11Cl3FN3O3 and a molecular weight of 382.61 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(5-fluoro-2,4-dioxo-1,3-diazinan-1-yl)ethyl]benzamide.
| Compound Name | N-[2,2,2-trichloro-1-(5-fluoro-2,4-dioxo-1,3-diazinan-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 74684281 |
| Molecular Formula | C13H11Cl3FN3O3 |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | N-[2,2,2-trichloro-1-(5-fluoro-2,4-dioxo-1,3-diazinan-1-yl)ethyl]benzamide |
| SMILES | O=C(NC(N1CC(F)C(=O)NC1=O)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C13H11Cl3FN3O3/c14-13(15,16)11(18-9(21)7-4-2-1-3-5-7)20-6-8(17)10(22)19-12(20)23/h1-5,8,11H,6H2,(H,18,21)(H,19,22,23) |
| InChIKey | UHBJSGOTUNJXOQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|