C37H42O5Si — CID 10984826
tert-butyl-[[(2S,3S,6R)-2-methoxy-3,5-bis(phenylmethoxy)-3,6-dihydro-2H-pyran-6-yl]methoxy]-diphenylsilane (PubChem CID 10984826) has the molecular formula C37H42O5Si and a molecular weight of 594.82 g/mol. Its IUPAC name is tert-butyl-[[(2S,3S,6R)-2-methoxy-3,5-bis(phenylmethoxy)-3,6-dihydro-2H-pyran-6-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,3S,6R)-2-methoxy-3,5-bis(phenylmethoxy)-3,6-dihydro-2H-pyran-6-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10984826 |
| Molecular Formula | C37H42O5Si |
| Molecular Weight | 594.82 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | tert-butyl-[[(2S,3S,6R)-2-methoxy-3,5-bis(phenylmethoxy)-3,6-dihydro-2H-pyran-6-yl]methoxy]-diphenylsilane |
| SMILES | CO[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(OCc2ccccc2)=C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H42O5Si/c1-37(2,3)43(31-21-13-7-14-22-31,32-23-15-8-16-24-32)41-28-35-33(39-26-29-17-9-5-10-18-29)25-34(36(38-4)42-35)40-27-30-19-11-6-12-20-30/h5-25,34-36H,26-28H2,1-4H3/t34-,35+,36-/m0/s1 |
| InChIKey | PYNNKGDSIXKRKP-PDHQKIGBSA-N |
| XLogP | 6.62 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.82 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|