C42H82S4Si6Sn — CID 10996715
[[3,5-bis[bis(trimethylsilyl)methyl]-2-[5-[2,4,6-tri(propan-2-yl)phenyl]tetrathiastannolan-5-yl]phenyl]-trimethylsilylmethyl]-trimethylsilane (PubChem CID 10996715) has the molecular formula C42H82S4Si6Sn and a molecular weight of 1002.61 g/mol. Its IUPAC name is [[3,5-bis[bis(trimethylsilyl)methyl]-2-[5-[2,4,6-tri(propan-2-yl)phenyl]tetrathiastannolan-5-yl]phenyl]-trimethylsilylmethyl]-trimethylsilane.
| Compound Name | [[3,5-bis[bis(trimethylsilyl)methyl]-2-[5-[2,4,6-tri(propan-2-yl)phenyl]tetrathiastannolan-5-yl]phenyl]-trimethylsilylmethyl]-trimethylsilane |
|---|---|
| PubChem CID | 10996715 |
| Molecular Formula | C42H82S4Si6Sn |
| Molecular Weight | 1002.61 g/mol |
| Exact Mass | 1002.29 |
| IUPAC Name | [[3,5-bis[bis(trimethylsilyl)methyl]-2-[5-[2,4,6-tri(propan-2-yl)phenyl]tetrathiastannolan-5-yl]phenyl]-trimethylsilylmethyl]-trimethylsilane |
| SMILES | CC(C)c1cc(C(C)C)c([Sn]2(c3c(C([Si](C)(C)C)[Si](C)(C)C)cc(C([Si](C)(C)C)[Si](C)(C)C)cc3C([Si](C)(C)C)[Si](C)(C)C)SSSS2)c(C(C)C)c1 |
| InChI | InChI=1S/C27H59Si6.C15H23.H2S4.Sn/c1-28(2,3)25(29(4,5)6)22-19-23(26(30(7,8)9)31(10,11)12)21-24(20-22)27(32(13,14)15)33(16,17)18;1-10(2)13-7-14(11(3)4)9-15(8-13)12(5)6;1-3-4-2;/h19-20,25-27H,1-18H3;7-8,10-12H,1-6H3;1-2H;/q;;;+2/p-2 |
| InChIKey | HKGKUJRLKCGWFX-UHFFFAOYSA-L |
| XLogP | 15.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.61 |
| LogP ≤ 5 | 15.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|