C35H43FN4O5 — CID 110066217
tert-butyl 4-[[5-(6-fluoro-3-pyridinyl)-15-methyl-16-oxo-9-oxa-12,15-diazatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-12-yl]methyl]-4-hydroxypiperidine-1-carboxylate (PubChem CID 110066217) has the molecular formula C35H43FN4O5 and a molecular weight of 618.75 g/mol. Its IUPAC name is tert-butyl 4-[[5-(6-fluoro-3-pyridinyl)-15-methyl-16-oxo-9-oxa-12,15-diazatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-12-yl]methyl]-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-(6-fluoro-3-pyridinyl)-15-methyl-16-oxo-9-oxa-12,15-diazatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-12-yl]methyl]-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 110066217 |
| Molecular Formula | C35H43FN4O5 |
| Molecular Weight | 618.75 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | tert-butyl 4-[[5-(6-fluoro-3-pyridinyl)-15-methyl-16-oxo-9-oxa-12,15-diazatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-12-yl]methyl]-4-hydroxypiperidine-1-carboxylate |
| SMILES | CN1CCN(CC2(O)CCN(C(=O)OC(C)(C)C)CC2)CCOc2ccc(-c3ccc(F)nc3)cc2Cc2cccc(c2)C1=O |
| InChI | InChI=1S/C35H43FN4O5/c1-34(2,3)45-33(42)40-14-12-35(43,13-15-40)24-39-17-16-38(4)32(41)27-7-5-6-25(20-27)21-29-22-26(8-10-30(29)44-19-18-39)28-9-11-31(36)37-23-28/h5-11,20,22-23,43H,12-19,21,24H2,1-4H3 |
| InChIKey | RRQOSOWPXFTHBO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.75 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|