C21H16F15NO4 — CID 11006717
methyl (Z)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]dec-2-enoate (PubChem CID 11006717) has the molecular formula C21H16F15NO4 and a molecular weight of 631.33 g/mol. Its IUPAC name is methyl (Z)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]dec-2-enoate.
| Compound Name | methyl (Z)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]dec-2-enoate |
|---|---|
| PubChem CID | 11006717 |
| Molecular Formula | C21H16F15NO4 |
| Molecular Weight | 631.33 g/mol |
| Exact Mass | 631.08 |
| IUPAC Name | methyl (Z)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)amino]dec-2-enoate |
| SMILES | COC(=O)/C=C(\NC(Cc1ccccc1)C(=O)OC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H16F15NO4/c1-40-13(38)9-12(37-11(14(39)41-2)8-10-6-4-3-5-7-10)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)20(32,33)21(34,35)36/h3-7,9,11,37H,8H2,1-2H3/b12-9- |
| InChIKey | QBCPQCVSFZJRCN-XFXZXTDPSA-N |
| XLogP | 5.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.33 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|