C17H24N6O2 — CID 110126716
[(4S,5S)-4-(6-aminopurin-9-yl)-5-hydroxyazepan-1-yl]-cyclopentylmethanone (PubChem CID 110126716) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is [(4S,5S)-4-(6-aminopurin-9-yl)-5-hydroxyazepan-1-yl]-cyclopentylmethanone.
| Compound Name | [(4S,5S)-4-(6-aminopurin-9-yl)-5-hydroxyazepan-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 110126716 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [(4S,5S)-4-(6-aminopurin-9-yl)-5-hydroxyazepan-1-yl]-cyclopentylmethanone |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CCN(C(=O)C2CCCC2)CC[C@@H]1O |
| InChI | InChI=1S/C17H24N6O2/c18-15-14-16(20-9-19-15)23(10-21-14)12-5-7-22(8-6-13(12)24)17(25)11-3-1-2-4-11/h9-13,24H,1-8H2,(H2,18,19,20)/t12-,13-/m0/s1 |
| InChIKey | ZUUZOEDIQLAHEH-STQMWFEESA-N |
| XLogP | 1.12 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |