C20H19F3N2O3S — CID 110165992
1-ethyl-2,3-dimethyl-N-[2-(trifluoromethyl)phenyl]sulfonylindole-5-carboxamide (PubChem CID 110165992) has the molecular formula C20H19F3N2O3S and a molecular weight of 424.44 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethyl-N-[2-(trifluoromethyl)phenyl]sulfonylindole-5-carboxamide.
| Compound Name | 1-ethyl-2,3-dimethyl-N-[2-(trifluoromethyl)phenyl]sulfonylindole-5-carboxamide |
|---|---|
| PubChem CID | 110165992 |
| Molecular Formula | C20H19F3N2O3S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 1-ethyl-2,3-dimethyl-N-[2-(trifluoromethyl)phenyl]sulfonylindole-5-carboxamide |
| SMILES | CCn1c(C)c(C)c2cc(C(=O)NS(=O)(=O)c3ccccc3C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H19F3N2O3S/c1-4-25-13(3)12(2)15-11-14(9-10-17(15)25)19(26)24-29(27,28)18-8-6-5-7-16(18)20(21,22)23/h5-11H,4H2,1-3H3,(H,24,26) |
| InChIKey | IQNKOCPVXWWUKJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|