C9H16N2O2S — CID 110192497
(4S)-3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 110192497) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is (4S)-3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 110192497 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (4S)-3-formyl-2,2,5,5-tetramethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CC1(C)SC(C)(C)N(C=O)[C@H]1C(N)=O |
| InChI | InChI=1S/C9H16N2O2S/c1-8(2)6(7(10)13)11(5-12)9(3,4)14-8/h5-6H,1-4H3,(H2,10,13)/t6-/m0/s1 |
| InChIKey | AFKAPVCKLBSNTK-LURJTMIESA-N |
| XLogP | 0.56 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|