C7H12N2O4S — CID 95987453
(4R)-3-formyl-2,2-dimethyl-1,1-dioxo-1,3-thiazolidine-4-carboxamide (PubChem CID 95987453) has the molecular formula C7H12N2O4S and a molecular weight of 220.25 g/mol. Its IUPAC name is (4R)-3-formyl-2,2-dimethyl-1,1-dioxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-formyl-2,2-dimethyl-1,1-dioxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 95987453 |
| Molecular Formula | C7H12N2O4S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | (4R)-3-formyl-2,2-dimethyl-1,1-dioxo-1,3-thiazolidine-4-carboxamide |
| SMILES | CC1(C)N(C=O)[C@H](C(N)=O)CS1(=O)=O |
| InChI | InChI=1S/C7H12N2O4S/c1-7(2)9(4-10)5(6(8)11)3-14(7,12)13/h4-5H,3H2,1-2H3,(H2,8,11)/t5-/m0/s1 |
| InChIKey | BLIABKVMKRSZIV-YFKPBYRVSA-N |
| XLogP | -1.54 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|