C28H36O6 — CID 11027046
1a-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-methoxy-4-(methoxymethoxy)-7a-(3-methylbut-2-enyl)naphtho[2,3-b]oxirene-2,7-dione (PubChem CID 11027046) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is 1a-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-methoxy-4-(methoxymethoxy)-7a-(3-methylbut-2-enyl)naphtho[2,3-b]oxirene-2,7-dione.
| Compound Name | 1a-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-methoxy-4-(methoxymethoxy)-7a-(3-methylbut-2-enyl)naphtho[2,3-b]oxirene-2,7-dione |
|---|---|
| PubChem CID | 11027046 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 1a-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-methoxy-4-(methoxymethoxy)-7a-(3-methylbut-2-enyl)naphtho[2,3-b]oxirene-2,7-dione |
| SMILES | COCOc1cc(OC)c2c(c1)C(=O)C1(C/C=C(\C)CCC=C(C)C)OC1(CC=C(C)C)C2=O |
| InChI | InChI=1S/C28H36O6/c1-18(2)9-8-10-20(5)12-14-27-25(29)22-15-21(33-17-31-6)16-23(32-7)24(22)26(30)28(27,34-27)13-11-19(3)4/h9,11-12,15-16H,8,10,13-14,17H2,1-7H3/b20-12+ |
| InChIKey | NMBZIRAKMGGMSW-UDWIEESQSA-N |
| XLogP | 6.00 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|