C14H18Cl2N2O5S — CID 110287643
3,6-dichloro-2-methoxy-N-(2-morpholin-4-ylsulfonylethyl)benzamide (PubChem CID 110287643) has the molecular formula C14H18Cl2N2O5S and a molecular weight of 397.28 g/mol. Its IUPAC name is 3,6-dichloro-2-methoxy-N-(2-morpholin-4-ylsulfonylethyl)benzamide.
| Compound Name | 3,6-dichloro-2-methoxy-N-(2-morpholin-4-ylsulfonylethyl)benzamide |
|---|---|
| PubChem CID | 110287643 |
| Molecular Formula | C14H18Cl2N2O5S |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 3,6-dichloro-2-methoxy-N-(2-morpholin-4-ylsulfonylethyl)benzamide |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)NCCS(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H18Cl2N2O5S/c1-22-13-11(16)3-2-10(15)12(13)14(19)17-4-9-24(20,21)18-5-7-23-8-6-18/h2-3H,4-9H2,1H3,(H,17,19) |
| InChIKey | DNQAWWHGNRPSBK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |