C21H32N2O4 — CID 11036191
(Z,4S,6R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,4-trimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-5-imine (PubChem CID 11036191) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is (Z,4S,6R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,4-trimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-5-imine.
| Compound Name | (Z,4S,6R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,4-trimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-5-imine |
|---|---|
| PubChem CID | 11036191 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (Z,4S,6R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,4-trimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-5-imine |
| SMILES | COC[C@@H]1CCCN1/N=C1/[C@H](C)OC(C)(C)O[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C21H32N2O4/c1-16-20(22-23-12-8-11-18(23)14-24-4)19(27-21(2,3)26-16)15-25-13-17-9-6-5-7-10-17/h5-7,9-10,16,18-19H,8,11-15H2,1-4H3/b22-20-/t16-,18-,19-/m0/s1 |
| InChIKey | RBURFTVAJSXBQL-GHGDRPKOSA-N |
| XLogP | 3.21 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|