C14H16N4O5S2 — CID 110371291
N-[5-[3-(1,3-benzodioxol-5-yl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110371291) has the molecular formula C14H16N4O5S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[5-[3-(1,3-benzodioxol-5-yl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[3-(1,3-benzodioxol-5-yl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110371291 |
| Molecular Formula | C14H16N4O5S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | N-[5-[3-(1,3-benzodioxol-5-yl)propylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)NCCCc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C14H16N4O5S2/c1-9(19)16-13-17-18-14(24-13)25(20,21)15-6-2-3-10-4-5-11-12(7-10)23-8-22-11/h4-5,7,15H,2-3,6,8H2,1H3,(H,16,17,19) |
| InChIKey | OMERFOFYILVRON-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|