C20H25BrN4O5S — CID 11038546
2-bromo-N-[6-[6-[[(2-nitrophenyl)sulfonylamino]methyl]-2-pyridinyl]hexyl]acetamide (PubChem CID 11038546) has the molecular formula C20H25BrN4O5S and a molecular weight of 513.41 g/mol. Its IUPAC name is 2-bromo-N-[6-[6-[[(2-nitrophenyl)sulfonylamino]methyl]-2-pyridinyl]hexyl]acetamide.
| Compound Name | 2-bromo-N-[6-[6-[[(2-nitrophenyl)sulfonylamino]methyl]-2-pyridinyl]hexyl]acetamide |
|---|---|
| PubChem CID | 11038546 |
| Molecular Formula | C20H25BrN4O5S |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | 2-bromo-N-[6-[6-[[(2-nitrophenyl)sulfonylamino]methyl]-2-pyridinyl]hexyl]acetamide |
| SMILES | O=C(CBr)NCCCCCCc1cccc(CNS(=O)(=O)c2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C20H25BrN4O5S/c21-14-20(26)22-13-6-2-1-3-8-16-9-7-10-17(24-16)15-23-31(29,30)19-12-5-4-11-18(19)25(27)28/h4-5,7,9-12,23H,1-3,6,8,13-15H2,(H,22,26) |
| InChIKey | NTXIBFRLUHRIOZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|