C14H8S2 — CID 11042862
11,14-dithiatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),12-heptaene (PubChem CID 11042862) has the molecular formula C14H8S2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 11,14-dithiatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),12-heptaene.
| Compound Name | 11,14-dithiatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),12-heptaene |
|---|---|
| PubChem CID | 11042862 |
| Molecular Formula | C14H8S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 11,14-dithiatetracyclo[7.6.1.05,16.010,15]hexadeca-1,3,5(16),6,8,10(15),12-heptaene |
| SMILES | C1=CSC2=C(S1)c1cccc3cccc2c13 |
| InChI | InChI=1S/C14H8S2/c1-3-9-4-2-6-11-12(9)10(5-1)13-14(11)16-8-7-15-13/h1-8H |
| InChIKey | SPLVNIPMAYBUKX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |