C17H32O2Si — CID 11044678
(2S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(5-methylcyclohexa-1,4-dien-1-yl)butan-2-ol (PubChem CID 11044678) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is (2S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(5-methylcyclohexa-1,4-dien-1-yl)butan-2-ol.
| Compound Name | (2S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(5-methylcyclohexa-1,4-dien-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 11044678 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (2S)-4-[tert-butyl(dimethyl)silyl]oxy-1-(5-methylcyclohexa-1,4-dien-1-yl)butan-2-ol |
| SMILES | CC1=CCC=C(C[C@H](O)CCO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C17H32O2Si/c1-14-8-7-9-15(12-14)13-16(18)10-11-19-20(5,6)17(2,3)4/h8-9,16,18H,7,10-13H2,1-6H3/t16-/m1/s1 |
| InChIKey | YKZHVHDVOBUHFN-MRXNPFEDSA-N |
| XLogP | 4.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|