C25H40O3Si — CID 11047999
methyl (2E,4E)-5-[(1S,2R)-2-[(1R,2R)-2-[(1R,2R)-2-[(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]cyclopropyl]cyclopropyl]cyclopropyl]penta-2,4-dienoate (PubChem CID 11047999) has the molecular formula C25H40O3Si and a molecular weight of 416.68 g/mol. Its IUPAC name is methyl (2E,4E)-5-[(1S,2R)-2-[(1R,2R)-2-[(1R,2R)-2-[(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]cyclopropyl]cyclopropyl]cyclopropyl]penta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-5-[(1S,2R)-2-[(1R,2R)-2-[(1R,2R)-2-[(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]cyclopropyl]cyclopropyl]cyclopropyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 11047999 |
| Molecular Formula | C25H40O3Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | methyl (2E,4E)-5-[(1S,2R)-2-[(1R,2R)-2-[(1R,2R)-2-[(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopropyl]cyclopropyl]cyclopropyl]cyclopropyl]penta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/[C@@H]1C[C@H]1[C@@H]1C[C@H]1[C@@H]1C[C@H]1[C@@H]1C[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40O3Si/c1-25(2,3)29(5,6)28-15-17-12-19(17)21-14-23(21)22-13-20(22)18-11-16(18)9-7-8-10-24(26)27-4/h7-10,16-23H,11-15H2,1-6H3/b9-7+,10-8+/t16-,17+,18-,19-,20+,21+,22-,23-/m1/s1 |
| InChIKey | PVTYISMBIHMEIS-IWJZMMHJSA-N |
| XLogP | 5.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|