C33H42O5Si — CID 11049887
tert-butyl-[(1'S,4S,5S)-5',8'-dimethoxy-2,2,5-trimethylspiro[1,3-dioxolane-4,3'-2,4-dihydro-1H-naphthalene]-1'-yl]oxy-diphenylsilane (PubChem CID 11049887) has the molecular formula C33H42O5Si and a molecular weight of 546.78 g/mol. Its IUPAC name is tert-butyl-[(1'S,4S,5S)-5',8'-dimethoxy-2,2,5-trimethylspiro[1,3-dioxolane-4,3'-2,4-dihydro-1H-naphthalene]-1'-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(1'S,4S,5S)-5',8'-dimethoxy-2,2,5-trimethylspiro[1,3-dioxolane-4,3'-2,4-dihydro-1H-naphthalene]-1'-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11049887 |
| Molecular Formula | C33H42O5Si |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | tert-butyl-[(1'S,4S,5S)-5',8'-dimethoxy-2,2,5-trimethylspiro[1,3-dioxolane-4,3'-2,4-dihydro-1H-naphthalene]-1'-yl]oxy-diphenylsilane |
| SMILES | COc1ccc(OC)c2c1C[C@@]1(C[C@@H]2O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O[C@H]1C |
| InChI | InChI=1S/C33H42O5Si/c1-23-33(38-32(5,6)36-23)21-26-27(34-7)19-20-28(35-8)30(26)29(22-33)37-39(31(2,3)4,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-20,23,29H,21-22H2,1-8H3/t23-,29-,33-/m0/s1 |
| InChIKey | ACLMYUSCPWZOBC-XKXZHMCDSA-N |
| XLogP | 6.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|