C24H24O7S2 — CID 11060025
(5'S,5'aS,8'aS)-5'-(3,4-dimethoxyphenyl)-5'-hydroxyspiro[1,3-dithiane-2,9'-8,8a-dihydro-5aH-[2]benzofuro[6,5-f][1,3]benzodioxole]-6'-one (PubChem CID 11060025) has the molecular formula C24H24O7S2 and a molecular weight of 488.58 g/mol. Its IUPAC name is (5'S,5'aS,8'aS)-5'-(3,4-dimethoxyphenyl)-5'-hydroxyspiro[1,3-dithiane-2,9'-8,8a-dihydro-5aH-[2]benzofuro[6,5-f][1,3]benzodioxole]-6'-one.
| Compound Name | (5'S,5'aS,8'aS)-5'-(3,4-dimethoxyphenyl)-5'-hydroxyspiro[1,3-dithiane-2,9'-8,8a-dihydro-5aH-[2]benzofuro[6,5-f][1,3]benzodioxole]-6'-one |
|---|---|
| PubChem CID | 11060025 |
| Molecular Formula | C24H24O7S2 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (5'S,5'aS,8'aS)-5'-(3,4-dimethoxyphenyl)-5'-hydroxyspiro[1,3-dithiane-2,9'-8,8a-dihydro-5aH-[2]benzofuro[6,5-f][1,3]benzodioxole]-6'-one |
| SMILES | COc1ccc([C@]2(O)c3cc4c(cc3C3(SCCCS3)[C@@H]3COC(=O)[C@@H]32)OCO4)cc1OC |
| InChI | InChI=1S/C24H24O7S2/c1-27-17-5-4-13(8-18(17)28-2)23(26)14-9-19-20(31-12-30-19)10-15(14)24(32-6-3-7-33-24)16-11-29-22(25)21(16)23/h4-5,8-10,16,21,26H,3,6-7,11-12H2,1-2H3/t16-,21-,23+/m1/s1 |
| InChIKey | KPSHBLZCVMSTKP-VZPUWSDOSA-N |
| XLogP | 3.49 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |