C14F21N — CID 11071967
(Z)-2,2,3,3,4,4,4-heptafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1-(2,3,4,5,6-pentafluorophenyl)butan-1-imine (PubChem CID 11071967) has the molecular formula C14F21N and a molecular weight of 581.12 g/mol. Its IUPAC name is (Z)-2,2,3,3,4,4,4-heptafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1-(2,3,4,5,6-pentafluorophenyl)butan-1-imine.
| Compound Name | (Z)-2,2,3,3,4,4,4-heptafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1-(2,3,4,5,6-pentafluorophenyl)butan-1-imine |
|---|---|
| PubChem CID | 11071967 |
| Molecular Formula | C14F21N |
| Molecular Weight | 581.12 g/mol |
| Exact Mass | 580.97 |
| IUPAC Name | (Z)-2,2,3,3,4,4,4-heptafluoro-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1-(2,3,4,5,6-pentafluorophenyl)butan-1-imine |
| SMILES | Fc1c(F)c(F)c(/C(=N/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C14F21N/c15-2-1(3(16)5(18)6(19)4(2)17)7(8(20,21)9(22,23)12(28,29)30)36-14(34,35)11(26,27)10(24,25)13(31,32)33/b36-7- |
| InChIKey | GHCHEUWVPWTUIM-HNBOPHLGSA-N |
| XLogP | 7.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.12 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|