C33H62O5Si2 — CID 11072044
methyl 4-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1E,5Z)-3-oxoundeca-1,5-dienyl]cyclopentyl]butanoate (PubChem CID 11072044) has the molecular formula C33H62O5Si2 and a molecular weight of 595.03 g/mol. Its IUPAC name is methyl 4-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1E,5Z)-3-oxoundeca-1,5-dienyl]cyclopentyl]butanoate.
| Compound Name | methyl 4-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1E,5Z)-3-oxoundeca-1,5-dienyl]cyclopentyl]butanoate |
|---|---|
| PubChem CID | 11072044 |
| Molecular Formula | C33H62O5Si2 |
| Molecular Weight | 595.03 g/mol |
| Exact Mass | 594.41 |
| IUPAC Name | methyl 4-[(1S,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(1E,5Z)-3-oxoundeca-1,5-dienyl]cyclopentyl]butanoate |
| SMILES | CCCCC/C=C\CC(=O)/C=C/[C@@H]1[C@H](CCCC(=O)OC)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H62O5Si2/c1-13-14-15-16-17-18-20-26(34)23-24-28-27(21-19-22-31(35)36-8)29(37-39(9,10)32(2,3)4)25-30(28)38-40(11,12)33(5,6)7/h17-18,23-24,27-30H,13-16,19-22,25H2,1-12H3/b18-17-,24-23+/t27-,28+,29-,30+/m0/s1 |
| InChIKey | ZHOAAIRRIBWMHP-XJYZOTIJSA-N |
| XLogP | 9.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.03 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|